C30H38F3N5OS — CID 177247263
4-N-[2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-1-N-ethylcyclohexane-1,4-diamine (PubChem CID 177247263) has the molecular formula C30H38F3N5OS and a molecular weight of 573.73 g/mol. Its IUPAC name is 4-N-[2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-1-N-ethylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-1-N-ethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 177247263 |
| Molecular Formula | C30H38F3N5OS |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 4-N-[2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-1-N-ethylcyclohexane-1,4-diamine |
| SMILES | CCNC1CCC(Nc2cccc3c2cc(C#CCNc2ccc(SN(C)C)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C30H38F3N5OS/c1-5-34-21-11-13-22(14-12-21)36-26-9-6-10-28-25(26)18-23(38(28)20-30(31,32)33)8-7-17-35-27-16-15-24(40-37(2)3)19-29(27)39-4/h6,9-10,15-16,18-19,21-22,34-36H,5,11-14,17,20H2,1-4H3 |
| InChIKey | HDLVCMSGEHOIBC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|