C30H38F3N5O2 — CID 156712956
4-[3-[4-[(1-ethylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;N-methylmethanamine (PubChem CID 156712956) has the molecular formula C30H38F3N5O2 and a molecular weight of 557.66 g/mol. Its IUPAC name is 4-[3-[4-[(1-ethylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;N-methylmethanamine.
| Compound Name | 4-[3-[4-[(1-ethylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;N-methylmethanamine |
|---|---|
| PubChem CID | 156712956 |
| Molecular Formula | C30H38F3N5O2 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 4-[3-[4-[(1-ethylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;N-methylmethanamine |
| SMILES | CCN1CCC(Nc2cccc3c2cc(C#CCNc2ccc(C=O)cc2OC)n3CC(F)(F)F)CC1.CNC |
| InChI | InChI=1S/C28H31F3N4O2.C2H7N/c1-3-34-14-11-21(12-15-34)33-24-7-4-8-26-23(24)17-22(35(26)19-28(29,30)31)6-5-13-32-25-10-9-20(18-36)16-27(25)37-2;1-3-2/h4,7-10,16-18,21,32-33H,3,11-15,19H2,1-2H3;3H,1-2H3 |
| InChIKey | YWEGZIGXDHQOGO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|