C28H34F3N5O2S — CID 156712435
S-[3-methoxy-4-[3-[4-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenyl]thiohydroxylamine (PubChem CID 156712435) has the molecular formula C28H34F3N5O2S and a molecular weight of 561.67 g/mol. Its IUPAC name is S-[3-methoxy-4-[3-[4-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenyl]thiohydroxylamine.
| Compound Name | S-[3-methoxy-4-[3-[4-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 156712435 |
| Molecular Formula | C28H34F3N5O2S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | S-[3-methoxy-4-[3-[4-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenyl]thiohydroxylamine |
| SMILES | COCCN1CCC(Nc2cccc3c2cc(C#CCNc2ccc(SN)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C28H34F3N5O2S/c1-37-16-15-35-13-10-20(11-14-35)34-24-6-3-7-26-23(24)17-21(36(26)19-28(29,30)31)5-4-12-33-25-9-8-22(39-32)18-27(25)38-2/h3,6-9,17-18,20,33-34H,10-16,19,32H2,1-2H3 |
| InChIKey | FZMLSRHQDJGREU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|