C25H31F3N4OS — CID 156712770
5-aminosulfanyl-2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]cyclohex-3-en-1-ol (PubChem CID 156712770) has the molecular formula C25H31F3N4OS and a molecular weight of 492.61 g/mol. Its IUPAC name is 5-aminosulfanyl-2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]cyclohex-3-en-1-ol.
| Compound Name | 5-aminosulfanyl-2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 156712770 |
| Molecular Formula | C25H31F3N4OS |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 5-aminosulfanyl-2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]cyclohex-3-en-1-ol |
| SMILES | NSC1C=CC(NCC#Cc2cc3c(NC4CCCCC4)cccc3n2CC(F)(F)F)C(O)C1 |
| InChI | InChI=1S/C25H31F3N4OS/c26-25(27,28)16-32-18(8-5-13-30-22-12-11-19(34-29)15-24(22)33)14-20-21(9-4-10-23(20)32)31-17-6-2-1-3-7-17/h4,9-12,14,17,19,22,24,30-31,33H,1-3,6-7,13,15-16,29H2 |
| InChIKey | IYKSQTSKZQKDTK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|