C33H42F3N5O4S — CID 156712969
3-[4-[[2-[3-[2-methoxy-4-(oxan-4-ylamino)sulfanylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propane-1,2-diol (PubChem CID 156712969) has the molecular formula C33H42F3N5O4S and a molecular weight of 661.79 g/mol. Its IUPAC name is 3-[4-[[2-[3-[2-methoxy-4-(oxan-4-ylamino)sulfanylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-[[2-[3-[2-methoxy-4-(oxan-4-ylamino)sulfanylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 156712969 |
| Molecular Formula | C33H42F3N5O4S |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | 3-[4-[[2-[3-[2-methoxy-4-(oxan-4-ylamino)sulfanylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propane-1,2-diol |
| SMILES | COc1cc(SNC2CCOCC2)ccc1NCC#Cc1cc2c(NC3CCN(CC(O)CO)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C33H42F3N5O4S/c1-44-32-19-27(46-39-24-11-16-45-17-12-24)7-8-30(32)37-13-3-4-25-18-28-29(5-2-6-31(28)41(25)22-33(34,35)36)38-23-9-14-40(15-10-23)20-26(43)21-42/h2,5-8,18-19,23-24,26,37-39,42-43H,9-17,20-22H2,1H3 |
| InChIKey | ZROSGFNPXBNETM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|