C32H40F3N5O3S2 — CID 162526187
acetaldehyde;2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-oxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 162526187) has the molecular formula C32H40F3N5O3S2 and a molecular weight of 663.83 g/mol. Its IUPAC name is acetaldehyde;2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-oxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | acetaldehyde;2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-oxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 162526187 |
| Molecular Formula | C32H40F3N5O3S2 |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | acetaldehyde;2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-oxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CC=O.COc1cc(SN2CCN(C)CC2)ccc1NCC#Cc1cc2c(NC3CCS(=O)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C30H36F3N5O2S2.C2H4O/c1-36-13-15-37(16-14-36)41-24-8-9-27(29(20-24)40-2)34-12-4-5-23-19-25-26(35-22-10-17-42(39)18-11-22)6-3-7-28(25)38(23)21-30(31,32)33;1-2-3/h3,6-9,19-20,22,34-35H,10-18,21H2,1-2H3;2H,1H3 |
| InChIKey | VJPUXJMXZMNPDO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|