C28H37F3N6O — CID 178089328
1-tert-butyl-4-methylpyrazole;N-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynyl]formamide (PubChem CID 178089328) has the molecular formula C28H37F3N6O and a molecular weight of 530.64 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpyrazole;N-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynyl]formamide.
| Compound Name | 1-tert-butyl-4-methylpyrazole;N-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynyl]formamide |
|---|---|
| PubChem CID | 178089328 |
| Molecular Formula | C28H37F3N6O |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 1-tert-butyl-4-methylpyrazole;N-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynyl]formamide |
| SMILES | CN1CCC(Nc2cccc3c2cc(C#CCNC=O)n3CC(F)(F)F)CC1.Cc1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23F3N4O.C8H14N2/c1-26-10-7-15(8-11-26)25-18-5-2-6-19-17(18)12-16(4-3-9-24-14-28)27(19)13-20(21,22)23;1-7-5-9-10(6-7)8(2,3)4/h2,5-6,12,14-15,25H,7-11,13H2,1H3,(H,24,28);5-6H,1-4H3 |
| InChIKey | FBRNJAFJKVSNCO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|