C24H28N4O4S2 — CID 130353197
N-(1,1-dioxothian-4-yl)-1-ethyl-2-[3-[(6-methylsulfonyl-3-pyridinyl)amino]prop-1-ynyl]indol-4-amine (PubChem CID 130353197) has the molecular formula C24H28N4O4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-1-ethyl-2-[3-[(6-methylsulfonyl-3-pyridinyl)amino]prop-1-ynyl]indol-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-1-ethyl-2-[3-[(6-methylsulfonyl-3-pyridinyl)amino]prop-1-ynyl]indol-4-amine |
|---|---|
| PubChem CID | 130353197 |
| Molecular Formula | C24H28N4O4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-1-ethyl-2-[3-[(6-methylsulfonyl-3-pyridinyl)amino]prop-1-ynyl]indol-4-amine |
| SMILES | CCn1c(C#CCNc2ccc(S(C)(=O)=O)nc2)cc2c(NC3CCS(=O)(=O)CC3)cccc21 |
| InChI | InChI=1S/C24H28N4O4S2/c1-3-28-20(6-5-13-25-19-9-10-24(26-17-19)33(2,29)30)16-21-22(7-4-8-23(21)28)27-18-11-14-34(31,32)15-12-18/h4,7-10,16-18,25,27H,3,11-15H2,1-2H3 |
| InChIKey | RYTGYBVCSRULIZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|