C31H36F3N5 — CID 162606187
4-N,4-N-dimethyl-1-N-[2-[3-[[6-(2-methylbut-3-yn-2-yl)-3-pyridinyl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine (PubChem CID 162606187) has the molecular formula C31H36F3N5 and a molecular weight of 535.66 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[2-[3-[[6-(2-methylbut-3-yn-2-yl)-3-pyridinyl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[2-[3-[[6-(2-methylbut-3-yn-2-yl)-3-pyridinyl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 162606187 |
| Molecular Formula | C31H36F3N5 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[2-[3-[[6-(2-methylbut-3-yn-2-yl)-3-pyridinyl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine |
| SMILES | C#CC(C)(C)c1ccc(NCC#Cc2cc3c(NC4CCC(N(C)C)CC4)cccc3n2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C31H36F3N5/c1-6-30(2,3)29-17-14-23(20-36-29)35-18-8-9-25-19-26-27(37-22-12-15-24(16-13-22)38(4)5)10-7-11-28(26)39(25)21-31(32,33)34/h1,7,10-11,14,17,19-20,22,24,35,37H,12-13,15-16,18,21H2,2-5H3 |
| InChIKey | KZBYWTNTDUVSHW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|