C26H22F6N4 — CID 10625318
trans-(1S,2S)-1-N,2-N-bis[7-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,2-diamine (PubChem CID 10625318) has the molecular formula C26H22F6N4 and a molecular weight of 504.48 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis[7-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis[7-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 10625318 |
| Molecular Formula | C26H22F6N4 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis[7-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,2-diamine |
| SMILES | FC(F)(F)c1ccc2c(N[C@H]3CCCC[C@@H]3Nc3ccnc4cc(C(F)(F)F)ccc34)ccnc2c1 |
| InChI | InChI=1S/C26H22F6N4/c27-25(28,29)15-5-7-17-19(9-11-33-23(17)13-15)35-21-3-1-2-4-22(21)36-20-10-12-34-24-14-16(26(30,31)32)6-8-18(20)24/h5-14,21-22H,1-4H2,(H,33,35)(H,34,36)/t21-,22-/m0/s1 |
| InChIKey | JQOWJUSHLIOOCI-VXKWHMMOSA-N |
| XLogP | 7.66 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |