C18H21F3N2O2 — CID 133402360
N-[3-(oxan-4-yloxy)propyl]-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 133402360) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[3-(oxan-4-yloxy)propyl]-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-[3-(oxan-4-yloxy)propyl]-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133402360 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[3-(oxan-4-yloxy)propyl]-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | FC(F)(F)c1ccc2c(NCCCOC3CCOCC3)ccnc2c1 |
| InChI | InChI=1S/C18H21F3N2O2/c19-18(20,21)13-2-3-15-16(4-8-23-17(15)12-13)22-7-1-9-25-14-5-10-24-11-6-14/h2-4,8,12,14H,1,5-7,9-11H2,(H,22,23) |
| InChIKey | FWEATWAXIHESAN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|