C14H19F3N2O2 — CID 122156197
N-[3-(oxan-4-yloxy)propyl]-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 122156197) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[3-(oxan-4-yloxy)propyl]-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-[3-(oxan-4-yloxy)propyl]-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 122156197 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[3-(oxan-4-yloxy)propyl]-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | FC(F)(F)c1cc(NCCCOC2CCOCC2)ccn1 |
| InChI | InChI=1S/C14H19F3N2O2/c15-14(16,17)13-10-11(2-6-19-13)18-5-1-7-21-12-3-8-20-9-4-12/h2,6,10,12H,1,3-5,7-9H2,(H,18,19) |
| InChIKey | CJQSTQVDBMMTJH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|