C11H15F3N2S — CID 114270158
N-(4-methylsulfanylbutyl)-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 114270158) has the molecular formula C11H15F3N2S and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-(4-methylsulfanylbutyl)-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 114270158 |
| Molecular Formula | C11H15F3N2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | CSCCCCNc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2S/c1-17-7-3-2-5-15-9-4-6-16-10(8-9)11(12,13)14/h4,6,8H,2-3,5,7H2,1H3,(H,15,16) |
| InChIKey | PPOBOOPQGKEDSI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|