C11H16N2O2S — CID 66286681
methyl 4-(3-methylsulfanylpropylamino)pyridine-2-carboxylate (PubChem CID 66286681) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is methyl 4-(3-methylsulfanylpropylamino)pyridine-2-carboxylate.
| Compound Name | methyl 4-(3-methylsulfanylpropylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66286681 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 4-(3-methylsulfanylpropylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NCCCSC)ccn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-15-11(14)10-8-9(4-6-13-10)12-5-3-7-16-2/h4,6,8H,3,5,7H2,1-2H3,(H,12,13) |
| InChIKey | UYTMPJKEUXBJTL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|