C11H13F3N2O2 — CID 79040373
methyl 4-(4,4,4-trifluorobutylamino)pyridine-2-carboxylate (PubChem CID 79040373) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 4-(4,4,4-trifluorobutylamino)pyridine-2-carboxylate.
| Compound Name | methyl 4-(4,4,4-trifluorobutylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 79040373 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl 4-(4,4,4-trifluorobutylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NCCCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-18-10(17)9-7-8(3-6-16-9)15-5-2-4-11(12,13)14/h3,6-7H,2,4-5H2,1H3,(H,15,16) |
| InChIKey | ZBKOWLFQUUJWNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|