C15H16N2O2S — CID 66286043
methyl 4-(2-phenylsulfanylethylamino)pyridine-2-carboxylate (PubChem CID 66286043) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 4-(2-phenylsulfanylethylamino)pyridine-2-carboxylate.
| Compound Name | methyl 4-(2-phenylsulfanylethylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66286043 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 4-(2-phenylsulfanylethylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NCCSc2ccccc2)ccn1 |
| InChI | InChI=1S/C15H16N2O2S/c1-19-15(18)14-11-12(7-8-17-14)16-9-10-20-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,16,17) |
| InChIKey | MIUQGSVKJOILIE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|