C18H21F3N2O2 — CID 133448497
4-[4-(2-methoxyethoxy)piperidin-1-yl]-7-(trifluoromethyl)quinoline (PubChem CID 133448497) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)piperidin-1-yl]-7-(trifluoromethyl)quinoline.
| Compound Name | 4-[4-(2-methoxyethoxy)piperidin-1-yl]-7-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 133448497 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)piperidin-1-yl]-7-(trifluoromethyl)quinoline |
| SMILES | COCCOC1CCN(c2ccnc3cc(C(F)(F)F)ccc23)CC1 |
| InChI | InChI=1S/C18H21F3N2O2/c1-24-10-11-25-14-5-8-23(9-6-14)17-4-7-22-16-12-13(18(19,20)21)2-3-15(16)17/h2-4,7,12,14H,5-6,8-11H2,1H3 |
| InChIKey | GZJRIQODTPKWLD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|