C18H18F3N3 — CID 133402449
4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline (PubChem CID 133402449) has the molecular formula C18H18F3N3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 133402449 |
| Molecular Formula | C18H18F3N3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1ccc2c(N3CCC(N4CC=CC4)C3)ccnc2c1 |
| InChI | InChI=1S/C18H18F3N3/c19-18(20,21)13-3-4-15-16(11-13)22-7-5-17(15)24-10-6-14(12-24)23-8-1-2-9-23/h1-5,7,11,14H,6,8-10,12H2 |
| InChIKey | NDQZLRJVFRYMQZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|