C19H24F3N3O — CID 133401394
1-[2-ethyl-4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]propan-2-ol (PubChem CID 133401394) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[2-ethyl-4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[2-ethyl-4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 133401394 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[2-ethyl-4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]propan-2-ol |
| SMILES | CCC1CN(c2ccnc3cc(C(F)(F)F)ccc23)CCN1CC(C)O |
| InChI | InChI=1S/C19H24F3N3O/c1-3-15-12-25(9-8-24(15)11-13(2)26)18-6-7-23-17-10-14(19(20,21)22)4-5-16(17)18/h4-7,10,13,15,26H,3,8-9,11-12H2,1-2H3 |
| InChIKey | OOWXSRMNUASXQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |