C17H19F3N2O — CID 133402824
4-[3-(ethoxymethyl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline (PubChem CID 133402824) has the molecular formula C17H19F3N2O and a molecular weight of 324.35 g/mol. Its IUPAC name is 4-[3-(ethoxymethyl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(ethoxymethyl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 133402824 |
| Molecular Formula | C17H19F3N2O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-[3-(ethoxymethyl)pyrrolidin-1-yl]-7-(trifluoromethyl)quinoline |
| SMILES | CCOCC1CCN(c2ccnc3cc(C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C17H19F3N2O/c1-2-23-11-12-6-8-22(10-12)16-5-7-21-15-9-13(17(18,19)20)3-4-14(15)16/h3-5,7,9,12H,2,6,8,10-11H2,1H3 |
| InChIKey | VBTIJZQMLQPAKM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |