C19H15F6N5 — CID 133401314
7-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoline (PubChem CID 133401314) has the molecular formula C19H15F6N5 and a molecular weight of 427.35 g/mol. Its IUPAC name is 7-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoline.
| Compound Name | 7-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 133401314 |
| Molecular Formula | C19H15F6N5 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 7-(trifluoromethyl)-4-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoline |
| SMILES | FC(F)(F)c1ccc2c(N3CCN(c4nccc(C(F)(F)F)n4)CC3)ccnc2c1 |
| InChI | InChI=1S/C19H15F6N5/c20-18(21,22)12-1-2-13-14(11-12)26-5-3-15(13)29-7-9-30(10-8-29)17-27-6-4-16(28-17)19(23,24)25/h1-6,11H,7-10H2 |
| InChIKey | XNOCVWVFIBAFEQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |