C19H15Cl2F3N4 — CID 170974269
7-chloro-4-[4-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]quinoline (PubChem CID 170974269) has the molecular formula C19H15Cl2F3N4 and a molecular weight of 427.26 g/mol. Its IUPAC name is 7-chloro-4-[4-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]quinoline.
| Compound Name | 7-chloro-4-[4-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 170974269 |
| Molecular Formula | C19H15Cl2F3N4 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 7-chloro-4-[4-[2-chloro-6-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]quinoline |
| SMILES | FC(F)(F)c1cc(N2CCN(c3ccnc4cc(Cl)ccc34)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C19H15Cl2F3N4/c20-12-1-2-14-15(9-12)25-4-3-16(14)28-7-5-27(6-8-28)13-10-17(19(22,23)24)26-18(21)11-13/h1-4,9-11H,5-8H2 |
| InChIKey | SMBQJGDKBOINRB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|