C19H16Cl3N3O2S — CID 2957990
7-chloro-4-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline (PubChem CID 2957990) has the molecular formula C19H16Cl3N3O2S and a molecular weight of 456.78 g/mol. Its IUPAC name is 7-chloro-4-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline.
| Compound Name | 7-chloro-4-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 2957990 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 7-chloro-4-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C19H16Cl3N3O2S/c20-13-1-3-15-18(11-13)23-6-5-19(15)24-7-9-25(10-8-24)28(26,27)14-2-4-16(21)17(22)12-14/h1-6,11-12H,7-10H2 |
| InChIKey | ZACLBOIAQNPMOB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |