C23H22ClN5O4S — CID 5301727
6-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]sulfonyl-1,4-dimethylquinoxaline-2,3-dione (PubChem CID 5301727) has the molecular formula C23H22ClN5O4S and a molecular weight of 499.98 g/mol. Its IUPAC name is 6-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]sulfonyl-1,4-dimethylquinoxaline-2,3-dione.
| Compound Name | 6-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]sulfonyl-1,4-dimethylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 5301727 |
| Molecular Formula | C23H22ClN5O4S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 6-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]sulfonyl-1,4-dimethylquinoxaline-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)N3CCN(c4ccnc5cc(Cl)ccc45)CC3)ccc21 |
| InChI | InChI=1S/C23H22ClN5O4S/c1-26-20-6-4-16(14-21(20)27(2)23(31)22(26)30)34(32,33)29-11-9-28(10-12-29)19-7-8-25-18-13-15(24)3-5-17(18)19/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | SLFCXUMWZCYUJY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|