C27H25ClF3N7 — CID 170974284
buta-1,3-diene;4-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-N-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170974284) has the molecular formula C27H25ClF3N7 and a molecular weight of 539.99 g/mol. Its IUPAC name is buta-1,3-diene;4-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-N-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | buta-1,3-diene;4-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-N-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170974284 |
| Molecular Formula | C27H25ClF3N7 |
| Molecular Weight | 539.99 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | buta-1,3-diene;4-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-N-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | C=CC=C.FC(F)(F)c1cc(N2CCN(c3ccnc4cc(Cl)ccc34)CC2)nc(Nc2ccncc2)n1 |
| InChI | InChI=1S/C23H19ClF3N7.C4H6/c24-15-1-2-17-18(13-15)29-8-5-19(17)33-9-11-34(12-10-33)21-14-20(23(25,26)27)31-22(32-21)30-16-3-6-28-7-4-16;1-3-4-2/h1-8,13-14H,9-12H2,(H,28,30,31,32);3-4H,1-2H2 |
| InChIKey | LXINTBBNPPCHRU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.99 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|