C21H20F3N3OS — CID 133405243
5-methyl-N-[1-[7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 133405243) has the molecular formula C21H20F3N3OS and a molecular weight of 419.47 g/mol. Its IUPAC name is 5-methyl-N-[1-[7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[1-[7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 133405243 |
| Molecular Formula | C21H20F3N3OS |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 5-methyl-N-[1-[7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(c3ccnc4cc(C(F)(F)F)ccc34)CC2)s1 |
| InChI | InChI=1S/C21H20F3N3OS/c1-13-2-5-19(29-13)20(28)26-15-7-10-27(11-8-15)18-6-9-25-17-12-14(21(22,23)24)3-4-16(17)18/h2-6,9,12,15H,7-8,10-11H2,1H3,(H,26,28) |
| InChIKey | OJWVVTUOWVBAOK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |