C14H16ClN3 — CID 57199203
7-chloro-N-[(3R)-1-methylpyrrolidin-3-yl]quinolin-4-amine (PubChem CID 57199203) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 7-chloro-N-[(3R)-1-methylpyrrolidin-3-yl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[(3R)-1-methylpyrrolidin-3-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 57199203 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 7-chloro-N-[(3R)-1-methylpyrrolidin-3-yl]quinolin-4-amine |
| SMILES | CN1CC[C@@H](Nc2ccnc3cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C14H16ClN3/c1-18-7-5-11(9-18)17-13-4-6-16-14-8-10(15)2-3-12(13)14/h2-4,6,8,11H,5,7,9H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | LWOWUHWFPBFQJE-LLVKDONJSA-N |
| XLogP | 3.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |