C25H29BrClN3O2 — CID 67197279
N-[1-[(4-bromo-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7-chloroquinolin-4-amine (PubChem CID 67197279) has the molecular formula C25H29BrClN3O2 and a molecular weight of 518.88 g/mol. Its IUPAC name is N-[1-[(4-bromo-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7-chloroquinolin-4-amine.
| Compound Name | N-[1-[(4-bromo-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 67197279 |
| Molecular Formula | C25H29BrClN3O2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | N-[1-[(4-bromo-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7-chloroquinolin-4-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ccnc4cc(Cl)ccc34)CC2)cc(OCC)c1Br |
| InChI | InChI=1S/C25H29BrClN3O2/c1-3-31-23-13-17(14-24(25(23)26)32-4-2)16-30-11-8-19(9-12-30)29-21-7-10-28-22-15-18(27)5-6-20(21)22/h5-7,10,13-15,19H,3-4,8-9,11-12,16H2,1-2H3,(H,28,29) |
| InChIKey | GZNIJUICWNFMMB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |