C25H26ClN3O2 — CID 87306097
7-chloro-N-[1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperidin-4-yl]quinolin-4-amine (PubChem CID 87306097) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 7-chloro-N-[1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperidin-4-yl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperidin-4-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 87306097 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 7-chloro-N-[1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperidin-4-yl]quinolin-4-amine |
| SMILES | C#CCOc1cc(CN2CCC(Nc3ccnc4cc(Cl)ccc34)CC2)ccc1OC |
| InChI | InChI=1S/C25H26ClN3O2/c1-3-14-31-25-15-18(4-7-24(25)30-2)17-29-12-9-20(10-13-29)28-22-8-11-27-23-16-19(26)5-6-21(22)23/h1,4-8,11,15-16,20H,9-10,12-14,17H2,2H3,(H,27,28) |
| InChIKey | DYBBEADIKZHSOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|