C24H33N3O2 — CID 67197649
N-[1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylpyridin-4-amine (PubChem CID 67197649) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylpyridin-4-amine.
| Compound Name | N-[1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylpyridin-4-amine |
|---|---|
| PubChem CID | 67197649 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-4-yl]-2-methylpyridin-4-amine |
| SMILES | COc1ccc(CN2CCC(Nc3ccnc(C)c3)CC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H33N3O2/c1-18-15-21(9-12-25-18)26-20-10-13-27(14-11-20)17-19-7-8-23(28-2)24(16-19)29-22-5-3-4-6-22/h7-9,12,15-16,20,22H,3-6,10-11,13-14,17H2,1-2H3,(H,25,26) |
| InChIKey | OAEQZAMEUHULPY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |