C22H32N4O2 — CID 68779447
N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-propylpyrimidin-2-amine (PubChem CID 68779447) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-propylpyrimidin-2-amine.
| Compound Name | N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 68779447 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]-5-propylpyrimidin-2-amine |
| SMILES | CCCc1cnc(NC2CCN(Cc3ccc(OC)c(OCC)c3)CC2)nc1 |
| InChI | InChI=1S/C22H32N4O2/c1-4-6-18-14-23-22(24-15-18)25-19-9-11-26(12-10-19)16-17-7-8-20(27-3)21(13-17)28-5-2/h7-8,13-15,19H,4-6,9-12,16H2,1-3H3,(H,23,24,25) |
| InChIKey | PSRDGCDNHDNMLY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |