C23H34N4O2 — CID 69151737
N-[1-[(3-ethoxy-4-pentoxyphenyl)methyl]piperidin-4-yl]pyrimidin-2-amine (PubChem CID 69151737) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[1-[(3-ethoxy-4-pentoxyphenyl)methyl]piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | N-[1-[(3-ethoxy-4-pentoxyphenyl)methyl]piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 69151737 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[1-[(3-ethoxy-4-pentoxyphenyl)methyl]piperidin-4-yl]pyrimidin-2-amine |
| SMILES | CCCCCOc1ccc(CN2CCC(Nc3ncccn3)CC2)cc1OCC |
| InChI | InChI=1S/C23H34N4O2/c1-3-5-6-16-29-21-9-8-19(17-22(21)28-4-2)18-27-14-10-20(11-15-27)26-23-24-12-7-13-25-23/h7-9,12-13,17,20H,3-6,10-11,14-16,18H2,1-2H3,(H,24,25,26) |
| InChIKey | HOTKDYAOTNMYQS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|