C20H26BrN3O2 — CID 24855078
5-bromo-N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]pyridin-2-amine (PubChem CID 24855078) has the molecular formula C20H26BrN3O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 5-bromo-N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]pyridin-2-amine.
| Compound Name | 5-bromo-N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 24855078 |
| Molecular Formula | C20H26BrN3O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-bromo-N-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]pyridin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ccc(Br)cn3)CC2)ccc1OC |
| InChI | InChI=1S/C20H26BrN3O2/c1-3-26-19-12-15(4-6-18(19)25-2)14-24-10-8-17(9-11-24)23-20-7-5-16(21)13-22-20/h4-7,12-13,17H,3,8-11,14H2,1-2H3,(H,22,23) |
| InChIKey | GZRXLOKUPKRJJQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |