C17H20BrN3 — CID 29049157
N-(1-benzylpiperidin-4-yl)-5-bromopyridin-2-amine (PubChem CID 29049157) has the molecular formula C17H20BrN3 and a molecular weight of 346.27 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-bromopyridin-2-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-bromopyridin-2-amine |
|---|---|
| PubChem CID | 29049157 |
| Molecular Formula | C17H20BrN3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-bromopyridin-2-amine |
| SMILES | Brc1ccc(NC2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C17H20BrN3/c18-15-6-7-17(19-12-15)20-16-8-10-21(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H,19,20) |
| InChIKey | RZOVRMPTBGASPO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |