C22H31IN4O3 — CID 68787117
N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine (PubChem CID 68787117) has the molecular formula C22H31IN4O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine.
| Compound Name | N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 68787117 |
| Molecular Formula | C22H31IN4O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ncc(CC)cn3)CC2)cc(OCOC)c1I |
| InChI | InChI=1S/C22H31IN4O3/c1-4-16-12-24-22(25-13-16)26-18-6-8-27(9-7-18)14-17-10-19(29-5-2)21(23)20(11-17)30-15-28-3/h10-13,18H,4-9,14-15H2,1-3H3,(H,24,25,26) |
| InChIKey | GATBNMQGJCIBFV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|