C22H27F3IN3O3 — CID 24854731
N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 24854731) has the molecular formula C22H27F3IN3O3 and a molecular weight of 565.37 g/mol. Its IUPAC name is N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 24854731 |
| Molecular Formula | C22H27F3IN3O3 |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ccc(C(F)(F)F)cn3)CC2)cc(OCOC)c1I |
| InChI | InChI=1S/C22H27F3IN3O3/c1-3-31-18-10-15(11-19(21(18)26)32-14-30-2)13-29-8-6-17(7-9-29)28-20-5-4-16(12-27-20)22(23,24)25/h4-5,10-12,17H,3,6-9,13-14H2,1-2H3,(H,27,28) |
| InChIKey | NZVJAIYUTCSIRH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|