C20H26ClIN4O3 — CID 87286723
2-chloro-N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]pyrimidin-4-amine (PubChem CID 87286723) has the molecular formula C20H26ClIN4O3 and a molecular weight of 532.81 g/mol. Its IUPAC name is 2-chloro-N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 87286723 |
| Molecular Formula | C20H26ClIN4O3 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 2-chloro-N-[1-[[3-ethoxy-4-iodo-5-(methoxymethoxy)phenyl]methyl]piperidin-4-yl]pyrimidin-4-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ccnc(Cl)n3)CC2)cc(OCOC)c1I |
| InChI | InChI=1S/C20H26ClIN4O3/c1-3-28-16-10-14(11-17(19(16)22)29-13-27-2)12-26-8-5-15(6-9-26)24-18-4-7-23-20(21)25-18/h4,7,10-11,15H,3,5-6,8-9,12-13H2,1-2H3,(H,23,24,25) |
| InChIKey | WMNHDJNWLJHQPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|