C21H30ClN5O3 — CID 87286691
N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-2-chloro-5-methoxypyrimidin-4-amine (PubChem CID 87286691) has the molecular formula C21H30ClN5O3 and a molecular weight of 435.96 g/mol. Its IUPAC name is N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-2-chloro-5-methoxypyrimidin-4-amine.
| Compound Name | N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-2-chloro-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 87286691 |
| Molecular Formula | C21H30ClN5O3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[1-[(4-amino-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-2-chloro-5-methoxypyrimidin-4-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc(Cl)ncc3OC)CC2)cc(OCC)c1N |
| InChI | InChI=1S/C21H30ClN5O3/c1-4-29-16-10-14(11-17(19(16)23)30-5-2)13-27-8-6-15(7-9-27)25-20-18(28-3)12-24-21(22)26-20/h10-12,15H,4-9,13,23H2,1-3H3,(H,24,25,26) |
| InChIKey | PPSWJJLGHKOHEB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|