C21H28ClN3O2 — CID 24826627
N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]pyridin-3-amine (PubChem CID 24826627) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]pyridin-3-amine.
| Compound Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 24826627 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]pyridin-3-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3cccnc3)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C21H28ClN3O2/c1-3-26-19-12-16(13-20(21(19)22)27-4-2)15-25-10-7-17(8-11-25)24-18-6-5-9-23-14-18/h5-6,9,12-14,17,24H,3-4,7-8,10-11,15H2,1-2H3 |
| InChIKey | RHXNYABNSYGOHI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |