C39H45ClN10O2 — CID 68967573
1-[2-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine (PubChem CID 68967573) has the molecular formula C39H45ClN10O2 and a molecular weight of 721.31 g/mol. Its IUPAC name is 1-[2-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine.
| Compound Name | 1-[2-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 68967573 |
| Molecular Formula | C39H45ClN10O2 |
| Molecular Weight | 721.31 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | 1-[2-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
| SMILES | CCOc1cc(CN2CCC(C3CC(N(N)c4ncc(-c5cccnc5)cn4)CCN3c3ncc(-c4cccnc4)cn3)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C39H45ClN10O2/c1-3-51-35-17-27(18-36(37(35)40)52-4-2)26-48-14-9-28(10-15-48)34-19-33(50(41)39-46-24-32(25-47-39)30-8-6-13-43-21-30)11-16-49(34)38-44-22-31(23-45-38)29-7-5-12-42-20-29/h5-8,12-13,17-18,20-25,28,33-34H,3-4,9-11,14-16,19,26,41H2,1-2H3 |
| InChIKey | ZLRYXZMUUABTQD-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.31 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|