C25H31ClN6O2 — CID 91569438
1-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine (PubChem CID 91569438) has the molecular formula C25H31ClN6O2 and a molecular weight of 483.02 g/mol. Its IUPAC name is 1-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine.
| Compound Name | 1-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 91569438 |
| Molecular Formula | C25H31ClN6O2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 1-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-1-(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
| SMILES | CCOc1cc(CN2CCC(N(N)c3ncc(-c4cccnc4)cn3)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C25H31ClN6O2/c1-3-33-22-12-18(13-23(24(22)26)34-4-2)17-31-10-7-21(8-11-31)32(27)25-29-15-20(16-30-25)19-6-5-9-28-14-19/h5-6,9,12-16,21H,3-4,7-8,10-11,17,27H2,1-2H3 |
| InChIKey | NZOBTRXESFBVJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|