C24H34ClN3O4 — CID 67401138
3-[[6-[[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]oxy]propan-1-ol (PubChem CID 67401138) has the molecular formula C24H34ClN3O4 and a molecular weight of 464.01 g/mol. Its IUPAC name is 3-[[6-[[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]oxy]propan-1-ol.
| Compound Name | 3-[[6-[[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 67401138 |
| Molecular Formula | C24H34ClN3O4 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-[[6-[[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]oxy]propan-1-ol |
| SMILES | CCOc1cc(CN2CCC(Nc3ccc(OCCCO)cn3)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C24H34ClN3O4/c1-3-30-21-14-18(15-22(24(21)25)31-4-2)17-28-10-8-19(9-11-28)27-23-7-6-20(16-26-23)32-13-5-12-29/h6-7,14-16,19,29H,3-5,8-13,17H2,1-2H3,(H,26,27) |
| InChIKey | IMQLLARZYAWSOA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|