C19H24Cl2N4O — CID 86618536
2-chloro-N-[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-5-methylpyrimidin-4-amine (PubChem CID 86618536) has the molecular formula C19H24Cl2N4O and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-chloro-N-[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-5-methylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 86618536 |
| Molecular Formula | C19H24Cl2N4O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-chloro-N-[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-5-methylpyrimidin-4-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc(Cl)ncc3C)CC2)ccc1Cl |
| InChI | InChI=1S/C19H24Cl2N4O/c1-3-26-17-10-14(4-5-16(17)20)12-25-8-6-15(7-9-25)23-18-13(2)11-22-19(21)24-18/h4-5,10-11,15H,3,6-9,12H2,1-2H3,(H,22,23,24) |
| InChIKey | BGSFALJZTYFEOP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |