C21H24ClN3O — CID 24854967
4-[[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]amino]benzonitrile (PubChem CID 24854967) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 4-[[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 24854967 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-[[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]amino]benzonitrile |
| SMILES | CCOc1cc(CN2CCC(Nc3ccc(C#N)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C21H24ClN3O/c1-2-26-21-13-17(5-8-20(21)22)15-25-11-9-19(10-12-25)24-18-6-3-16(14-23)4-7-18/h3-8,13,19,24H,2,9-12,15H2,1H3 |
| InChIKey | IUVYZYAMTOPPLM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |