C21H29N5O3 — CID 55457022
ethyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 55457022) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is ethyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55457022 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | ethyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)N2CCN(Cc3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H29N5O3/c1-2-29-21(28)26-9-7-19(8-10-26)23-20(27)25-13-11-24(12-14-25)16-18-5-3-17(15-22)4-6-18/h3-6,19H,2,7-14,16H2,1H3,(H,23,27) |
| InChIKey | CWKMPSOECOVFJB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |