C18H25N5O — CID 48957087
4-cyano-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-1-carboxamide (PubChem CID 48957087) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-cyano-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-1-carboxamide.
| Compound Name | 4-cyano-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 48957087 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-cyano-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-1-carboxamide |
| SMILES | N#CC1CCN(C(=O)NC2CCN(Cc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C18H25N5O/c19-13-15-3-11-23(12-4-15)18(24)21-17-5-9-22(10-6-17)14-16-1-7-20-8-2-16/h1-2,7-8,15,17H,3-6,9-12,14H2,(H,21,24) |
| InChIKey | DDTYURQIPDOVMH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |