C29H36N4O2 — CID 67198548
N-[1-[(4-cyclopentyloxy-3-ethoxyphenyl)methyl]piperidin-4-yl]-2-phenylpyrimidin-5-amine (PubChem CID 67198548) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[1-[(4-cyclopentyloxy-3-ethoxyphenyl)methyl]piperidin-4-yl]-2-phenylpyrimidin-5-amine.
| Compound Name | N-[1-[(4-cyclopentyloxy-3-ethoxyphenyl)methyl]piperidin-4-yl]-2-phenylpyrimidin-5-amine |
|---|---|
| PubChem CID | 67198548 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-[1-[(4-cyclopentyloxy-3-ethoxyphenyl)methyl]piperidin-4-yl]-2-phenylpyrimidin-5-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3cnc(-c4ccccc4)nc3)CC2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C29H36N4O2/c1-2-34-28-18-22(12-13-27(28)35-26-10-6-7-11-26)21-33-16-14-24(15-17-33)32-25-19-30-29(31-20-25)23-8-4-3-5-9-23/h3-5,8-9,12-13,18-20,24,26,32H,2,6-7,10-11,14-17,21H2,1H3 |
| InChIKey | MVAQNWIQWKVOJT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |