C19H18ClN5OS — CID 17206254
1-[3-(1-phenyltetrazol-5-yl)oxyphenyl]-N-(thiophen-2-ylmethyl)methanamine;hydrochloride (PubChem CID 17206254) has the molecular formula C19H18ClN5OS and a molecular weight of 399.91 g/mol. Its IUPAC name is 1-[3-(1-phenyltetrazol-5-yl)oxyphenyl]-N-(thiophen-2-ylmethyl)methanamine;hydrochloride.
| Compound Name | 1-[3-(1-phenyltetrazol-5-yl)oxyphenyl]-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 17206254 |
| Molecular Formula | C19H18ClN5OS |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[3-(1-phenyltetrazol-5-yl)oxyphenyl]-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
| SMILES | Cl.c1ccc(-n2nnnc2Oc2cccc(CNCc3cccs3)c2)cc1 |
| InChI | InChI=1S/C19H17N5OS.ClH/c1-2-7-16(8-3-1)24-19(21-22-23-24)25-17-9-4-6-15(12-17)13-20-14-18-10-5-11-26-18;/h1-12,20H,13-14H2;1H |
| InChIKey | BDOMWEGIYOQBNC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |