C20H28Cl2N6O — CID 17216139
N',N'-diethyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 17216139) has the molecular formula C20H28Cl2N6O and a molecular weight of 439.39 g/mol. Its IUPAC name is N',N'-diethyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N',N'-diethyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17216139 |
| Molecular Formula | C20H28Cl2N6O |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N',N'-diethyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNCc1cccc(Oc2nnnn2-c2ccccc2)c1.Cl.Cl |
| InChI | InChI=1S/C20H26N6O.2ClH/c1-3-25(4-2)14-13-21-16-17-9-8-12-19(15-17)27-20-22-23-24-26(20)18-10-6-5-7-11-18;;/h5-12,15,21H,3-4,13-14,16H2,1-2H3;2*1H |
| InChIKey | DPCKGDMOVMVKSP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|