C18H21N5O2 — CID 17206251
2-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]butan-1-ol (PubChem CID 17206251) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]butan-1-ol.
| Compound Name | 2-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 17206251 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1cccc(Oc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H21N5O2/c1-2-15(13-24)19-12-14-7-6-10-17(11-14)25-18-20-21-22-23(18)16-8-4-3-5-9-16/h3-11,15,19,24H,2,12-13H2,1H3 |
| InChIKey | JKEKWYMGUMNUBP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |